EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28FN2O2 |
| Net Charge | +1 |
| Average Mass | 395.498 |
| Monoisotopic Mass | 395.21293 |
| SMILES | CC1(C)C(=O)N(CC[NH+]2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H27FN2O2/c1-24(2)20-5-3-4-6-21(20)27(23(24)29)16-15-26-13-11-18(12-14-26)22(28)17-7-9-19(25)10-8-17/h3-10,18H,11-16H2,1-2H3/p+1 |
| InChIKey | KDXISMANFPJVJY-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY-310762(1+) (CHEBI:140938) is a ammonium ion derivative (CHEBI:35274) |
| LY-310762(1+) (CHEBI:140938) is conjugate acid of LY-310762 (CHEBI:140937) |
| Incoming Relation(s) |
| LY-310762 hydrochloride (CHEBI:140935) has part LY-310762(1+) (CHEBI:140938) |
| LY-310762 (CHEBI:140937) is conjugate base of LY-310762(1+) (CHEBI:140938) |
| IUPAC Name |
|---|
| 1-[2-(3,3-dimethyl-2-oxo-2,3-dihydro-1H-indol-1-yl)ethyl]-4-(4-fluorobenzoyl)piperidinium |