EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:140935 - LY-310762 hydrochloride
| Formula | C24H27FN2O2.HCl |
| Net Charge | 0 |
| Average Mass | 430.951 |
| Monoisotopic Mass | 430.18233 |
| SMILES | CC1(C)C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccccc21.Cl |
| InChI | InChI=1S/C24H27FN2O2.ClH/c1-24(2)20-5-3-4-6-21(20)27(23(24)29)16-15-26-13-11-18(12-14-26)22(28)17-7-9-19(25)10-8-17;/h3-10,18H,11-16H2,1-2H3;1H |
| InChIKey | BOCLFQZPFYNVFD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | receptor modulator A drug that acts as an antagonist, agonist, reverse agonist, or in some other fashion when interacting with cellular receptors. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY-310762 hydrochloride (CHEBI:140935) has part LY-310762(1+) (CHEBI:140938) |
| LY-310762 hydrochloride (CHEBI:140935) has role receptor modulator (CHEBI:90710) |
| LY-310762 hydrochloride (CHEBI:140935) has role serotonergic antagonist (CHEBI:48279) |
| LY-310762 hydrochloride (CHEBI:140935) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 1-[2-(3,3-dimethyl-2-oxo-2,3-dihydro-1H-indol-1-yl)ethyl]-4-(4-fluorobenzoyl)piperidinium chloride |
| 1-{2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl}-3,3-dimethyl-1,3-dihydro-2H-indol-2-one hydrochloride |
| Synonyms | Source |
|---|---|
| LY310762 hydrochloride | SUBMITTER |
| LY-310,762 hydrochloride | SUBMITTER |
| 1-[2-[4-(4-Fluorobenzoyl)-1-piperidinyl]ethyl]-1,3-dihydro-3,3-dimethyl-2H-indol-2-one hydrochloride | SUBMITTER |
| LY310762 HCl | ChEBI |
| LY-310762 HCl | ChEBI |
| LY-310762 hydrochloride | ChEBI |