EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27FN2O2 |
| Net Charge | 0 |
| Average Mass | 394.490 |
| Monoisotopic Mass | 394.20566 |
| SMILES | CC1(C)C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H27FN2O2/c1-24(2)20-5-3-4-6-21(20)27(23(24)29)16-15-26-13-11-18(12-14-26)22(28)17-7-9-19(25)10-8-17/h3-10,18H,11-16H2,1-2H3 |
| InChIKey | KDXISMANFPJVJY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. receptor modulator A drug that acts as an antagonist, agonist, reverse agonist, or in some other fashion when interacting with cellular receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY-310762 (CHEBI:140937) has role receptor modulator (CHEBI:90710) |
| LY-310762 (CHEBI:140937) has role serotonergic antagonist (CHEBI:48279) |
| LY-310762 (CHEBI:140937) is a aromatic ketone (CHEBI:76224) |
| LY-310762 (CHEBI:140937) is a monofluorobenzenes (CHEBI:83575) |
| LY-310762 (CHEBI:140937) is a oxindoles (CHEBI:38459) |
| LY-310762 (CHEBI:140937) is a piperidines (CHEBI:26151) |
| LY-310762 (CHEBI:140937) is a tertiary amino compound (CHEBI:50996) |
| LY-310762 (CHEBI:140937) is conjugate base of LY-310762(1+) (CHEBI:140938) |
| Incoming Relation(s) |
| LY-310762(1+) (CHEBI:140938) is conjugate acid of LY-310762 (CHEBI:140937) |
| IUPAC Name |
|---|
| 1-{2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl}-3,3-dimethyl-1,3-dihydro-2H-indol-2-one |
| Synonyms | Source |
|---|---|
| LY 310762 | ChEBI |
| LY-310,762 | ChEBI |
| LY310762 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LY-310762 | Wikipedia |
| Citations |
|---|