EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27FN2O2 |
| Net Charge | 0 |
| Average Mass | 394.490 |
| Monoisotopic Mass | 394.20566 |
| SMILES | CC1(C)C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H27FN2O2/c1-24(2)20-5-3-4-6-21(20)27(23(24)29)16-15-26-13-11-18(12-14-26)22(28)17-7-9-19(25)10-8-17/h3-10,18H,11-16H2,1-2H3 |
| InChIKey | KDXISMANFPJVJY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | receptor modulator A drug that acts as an antagonist, agonist, reverse agonist, or in some other fashion when interacting with cellular receptors. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY-310762 (CHEBI:140937) has role receptor modulator (CHEBI:90710) |
| LY-310762 (CHEBI:140937) has role serotonergic antagonist (CHEBI:48279) |
| LY-310762 (CHEBI:140937) is a aromatic ketone (CHEBI:76224) |
| LY-310762 (CHEBI:140937) is a monofluorobenzenes (CHEBI:83575) |
| LY-310762 (CHEBI:140937) is a oxindoles (CHEBI:38459) |
| LY-310762 (CHEBI:140937) is a piperidines (CHEBI:26151) |
| LY-310762 (CHEBI:140937) is a tertiary amino compound (CHEBI:50996) |
| LY-310762 (CHEBI:140937) is conjugate base of LY-310762(1+) (CHEBI:140938) |
| Incoming Relation(s) |
| LY-310762(1+) (CHEBI:140938) is conjugate acid of LY-310762 (CHEBI:140937) |
| IUPAC Name |
|---|
| 1-{2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl}-3,3-dimethyl-1,3-dihydro-2H-indol-2-one |
| Synonyms | Source |
|---|---|
| LY 310762 | ChEBI |
| LY-310,762 | ChEBI |
| LY310762 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LY-310762 | Wikipedia |
| Citations |
|---|