EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19NOS |
| Net Charge | 0 |
| Average Mass | 309.434 |
| Monoisotopic Mass | 309.11874 |
| SMILES | CN1CCC(=C2c3ccccc3CC(=O)c3sccc32)CC1 |
| InChI | InChI=1S/C19H19NOS/c1-20-9-6-13(7-10-20)18-15-5-3-2-4-14(15)12-17(21)19-16(18)8-11-22-19/h2-5,8,11H,6-7,9-10,12H2,1H3 |
| InChIKey | ZCVMWBYGMWKGHF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-asthmatic drug A drug used to treat asthma. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ketotifen (CHEBI:92511) has role anti-asthmatic drug (CHEBI:49167) |
| ketotifen (CHEBI:92511) has role H1-receptor antagonist (CHEBI:37955) |
| ketotifen (CHEBI:92511) is a cyclic ketone (CHEBI:3992) |
| ketotifen (CHEBI:92511) is a olefinic compound (CHEBI:78840) |
| ketotifen (CHEBI:92511) is a organic heterotricyclic compound (CHEBI:26979) |
| ketotifen (CHEBI:92511) is a organosulfur heterocyclic compound (CHEBI:38106) |
| ketotifen (CHEBI:92511) is a piperidines (CHEBI:26151) |
| ketotifen (CHEBI:92511) is a tertiary amino compound (CHEBI:50996) |
| ketotifen (CHEBI:92511) is conjugate base of ketotifen(1+) (CHEBI:140417) |
| Incoming Relation(s) |
| ketotifen(1+) (CHEBI:140417) is conjugate acid of ketotifen (CHEBI:92511) |
| IUPAC Name |
|---|
| 4-(1-methylpiperidin-4-ylidene)-4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one |
| INNs | Source |
|---|---|
| ketotifen | ChemIDplus |
| kétotifène | ChemIDplus |
| ketotifeno | ChemIDplus |
| ketotifenum | ChemIDplus |
| Synonym | Source |
|---|---|
| 10-(1-methyl-4-piperidinylidene)-5H-benzo[1,2]cyclohepta[3,4-b]thiophen-4-one | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:34580-13-7 | ChemIDplus |
| CAS:34580-13-7 | DrugCentral |
| CAS:34580-13-7 | NIST Chemistry WebBook |