EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O5 |
| Net Charge | 0 |
| Average Mass | 376.493 |
| Monoisotopic Mass | 376.22497 |
| SMILES | O=C(O)CC/C=C\C/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)C/C=C\CCO |
| InChI | InChI=1S/C22H32O5/c23-19-13-7-11-17-21(25)16-10-6-5-9-15-20(24)14-8-3-1-2-4-12-18-22(26)27/h2-11,15-16,20-21,23-25H,1,12-14,17-19H2,(H,26,27)/b4-2-,6-5+,8-3-,11-7-,15-9+,16-10-/t20-,21-/m1/s1 |
| InChIKey | RXZULUQRGUAOLG-OCDBVANQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25247845) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Applications: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 22-hydroxyprotectin D1 (CHEBI:140243) has functional parent protectin D1 (CHEBI:138655) |
| 22-hydroxyprotectin D1 (CHEBI:140243) has role anti-inflammatory agent (CHEBI:67079) |
| 22-hydroxyprotectin D1 (CHEBI:140243) has role human xenobiotic metabolite (CHEBI:76967) |
| 22-hydroxyprotectin D1 (CHEBI:140243) has role specialised pro-resolving mediator (CHEBI:140399) |
| 22-hydroxyprotectin D1 (CHEBI:140243) is a docosanoid (CHEBI:131863) |
| 22-hydroxyprotectin D1 (CHEBI:140243) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 22-hydroxyprotectin D1 (CHEBI:140243) is a protectin (CHEBI:193572) |
| 22-hydroxyprotectin D1 (CHEBI:140243) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 22-hydroxyprotectin D1 (CHEBI:140243) is conjugate acid of 22-hydroxyprotectin D1(1−) (CHEBI:140348) |
| Incoming Relation(s) |
| 22-hydroxyprotectin D1(1−) (CHEBI:140348) is conjugate base of 22-hydroxyprotectin D1 (CHEBI:140243) |
| IUPAC Name |
|---|
| (4Z,7Z,10R,11E,13E,15Z,17S,19Z)-10,17,22-trihydroxydocosa-4,7,11,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 22-OH-(N)PD1 | SUBMITTER |
| 22-hydroxyneuroprotectin D1 | ChEBI |
| 22-hydroxy-(neuro)protectin D1 | ChEBI |
| 10(R),17(S),20-trihydroxydocosa-4Z,7Z,11E,13E,15Z,19Z-hexaenoic acid | ChEBI |
| (4Z,7Z,10R,11E,13E,15Z,17S,19Z)-10,17,22-trihydroxydocosahexaenoic acid | ChEBI |
| 22-OH-PD1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27632053 | Reaxys |
| Citations |
|---|