EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:138655 - protectin D1
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | CC/C=C\C[C@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H32O4/c1-2-3-10-15-20(23)17-12-8-9-13-18-21(24)16-11-6-4-5-7-14-19-22(25)26/h3,5-13,17-18,20-21,23-24H,2,4,14-16,19H2,1H3,(H,25,26)/b7-5-,9-8+,10-3-,11-6-,17-12-,18-13+/t20-,21+/m0/s1 |
| InChIKey | CRDZYJSQHCXHEG-SFVBTVKNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24262603) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. PPARgamma agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-γ. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protectin D1 (CHEBI:138655) has role anti-inflammatory agent (CHEBI:67079) |
| protectin D1 (CHEBI:138655) has role apoptosis inhibitor (CHEBI:68494) |
| protectin D1 (CHEBI:138655) has role hepatoprotective agent (CHEBI:62868) |
| protectin D1 (CHEBI:138655) has role human xenobiotic metabolite (CHEBI:76967) |
| protectin D1 (CHEBI:138655) has role neuroprotective agent (CHEBI:63726) |
| protectin D1 (CHEBI:138655) has role PPARγ agonist (CHEBI:71554) |
| protectin D1 (CHEBI:138655) has role specialised pro-resolving mediator (CHEBI:140399) |
| protectin D1 (CHEBI:138655) is a dihydroxydocosahexaenoic acid (CHEBI:137348) |
| protectin D1 (CHEBI:138655) is a protectin (CHEBI:193572) |
| protectin D1 (CHEBI:138655) is a secondary allylic alcohol (CHEBI:134396) |
| protectin D1 (CHEBI:138655) is conjugate acid of protectin D1(1−) (CHEBI:195348) |
| Incoming Relation(s) |
| 22-hydroxyprotectin D1 (CHEBI:140243) has functional parent protectin D1 (CHEBI:138655) |
| protectin D1(1−) (CHEBI:195348) is conjugate base of protectin D1 (CHEBI:138655) |
| IUPAC Name |
|---|
| (4Z,7Z,10R,11E,13E,15Z,17S,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 10(R),17(S)-dihydroxydocosa-4Z,7Z,11E,13E,15Z,19Z-hexaenoic acid | ChEBI |
| (4Z,7Z,10R,11E,13E,15Z,17S,19Z)-10,17-dihydroxydocosahexaenoic acid | ChEBI |
| (neuro)protectin D1 | ChEBI |
| neuroprotectin D1 | ChEBI |
| (N)PD1 | SUBMITTER |
| NPD1 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0003689 | HMDB |
| Protectin_D1 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18351330 | Reaxys |
| Citations |
|---|