EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | CC/C=C\C[C@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H32O4/c1-2-3-10-15-20(23)17-12-8-9-13-18-21(24)16-11-6-4-5-7-14-19-22(25)26/h3,5-13,17-18,20-21,23-24H,2,4,14-16,19H2,1H3,(H,25,26)/b7-5-,9-8+,10-3-,11-6-,17-12-,18-13+/t20-,21+/m0/s1 |
| InChIKey | CRDZYJSQHCXHEG-SFVBTVKNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24262603) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. PPARgamma agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-γ. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protectin D1 (CHEBI:138655) has role anti-inflammatory agent (CHEBI:67079) |
| protectin D1 (CHEBI:138655) has role apoptosis inhibitor (CHEBI:68494) |
| protectin D1 (CHEBI:138655) has role hepatoprotective agent (CHEBI:62868) |
| protectin D1 (CHEBI:138655) has role human xenobiotic metabolite (CHEBI:76967) |
| protectin D1 (CHEBI:138655) has role neuroprotective agent (CHEBI:63726) |
| protectin D1 (CHEBI:138655) has role PPARγ agonist (CHEBI:71554) |
| protectin D1 (CHEBI:138655) has role specialised pro-resolving mediator (CHEBI:140399) |
| protectin D1 (CHEBI:138655) is a dihydroxydocosahexaenoic acid (CHEBI:137348) |
| protectin D1 (CHEBI:138655) is a protectin (CHEBI:193572) |
| protectin D1 (CHEBI:138655) is a secondary allylic alcohol (CHEBI:134396) |
| protectin D1 (CHEBI:138655) is conjugate acid of protectin D1(1−) (CHEBI:195348) |
| Incoming Relation(s) |
| 22-hydroxyprotectin D1 (CHEBI:140243) has functional parent protectin D1 (CHEBI:138655) |
| protectin D1(1−) (CHEBI:195348) is conjugate base of protectin D1 (CHEBI:138655) |
| IUPAC Name |
|---|
| (4Z,7Z,10R,11E,13E,15Z,17S,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 10(R),17(S)-dihydroxydocosa-4Z,7Z,11E,13E,15Z,19Z-hexaenoic acid | ChEBI |
| (4Z,7Z,10R,11E,13E,15Z,17S,19Z)-10,17-dihydroxydocosahexaenoic acid | ChEBI |
| (neuro)protectin D1 | ChEBI |
| neuroprotectin D1 | ChEBI |
| (N)PD1 | SUBMITTER |
| NPD1 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0003689 | HMDB |
| Protectin_D1 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18351330 | Reaxys |
| Citations |
|---|