EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31O5 |
| Net Charge | -1 |
| Average Mass | 375.485 |
| Monoisotopic Mass | 375.21770 |
| SMILES | O=C([O-])CC/C=C\C/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)C/C=C\CCO |
| InChI | InChI=1S/C22H32O5/c23-19-13-7-11-17-21(25)16-10-6-5-9-15-20(24)14-8-3-1-2-4-12-18-22(26)27/h2-11,15-16,20-21,23-25H,1,12-14,17-19H2,(H,26,27)/p-1/b4-2-,6-5+,8-3-,11-7-,15-9+,16-10-/t20-,21-/m1/s1 |
| InChIKey | RXZULUQRGUAOLG-OCDBVANQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 22-hydroxyprotectin D1(1−) (CHEBI:140348) is a docosanoid anion (CHEBI:131864) |
| 22-hydroxyprotectin D1(1−) (CHEBI:140348) is a hydroxy polyunsaturated fatty acid anion (CHEBI:131871) |
| 22-hydroxyprotectin D1(1−) (CHEBI:140348) is a ω-hydroxy-long-chain fatty acid anion (CHEBI:140992) |
| 22-hydroxyprotectin D1(1−) (CHEBI:140348) is conjugate base of 22-hydroxyprotectin D1 (CHEBI:140243) |
| Incoming Relation(s) |
| 22-hydroxyprotectin D1 (CHEBI:140243) is conjugate acid of 22-hydroxyprotectin D1(1−) (CHEBI:140348) |
| IUPAC Name |
|---|
| (4Z,7Z,10R,11E,13E,15Z,17S,19Z)-10,17,22-trihydroxydocosa-4,7,11,13,15,19-hexaenoate |
| Synonyms | Source |
|---|---|
| 22-hydroxy-(neuro)protectin D1(1−) | ChEBI |
| 10(R),17(S),20-trihydroxydocosa-4Z,7Z,11E,13E,15Z,19Z-hexaenoate | ChEBI |
| 22-hydroxyneuroprotectin D1(1−) | ChEBI |
| (4Z,7Z,10R,11E,13E,15Z,17S,19Z)-10,17,22-trihydroxydocosahexaenoate | ChEBI |
| 22-OH-PD1(1−) | ChEBI |
| 22-OH-(N)PD1(1−) | ChEBI |