EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26NO7 |
| Net Charge | -1 |
| Average Mass | 404.439 |
| Monoisotopic Mass | 404.17148 |
| SMILES | C[C@H](CCCC(=O)[O-])O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2cnc3ccccc23)C[C@H]1O |
| InChI | InChI=1S/C21H27NO7/c1-12(6-5-9-19(24)25)27-21-17(23)10-18(13(2)28-21)29-20(26)15-11-22-16-8-4-3-7-14(15)16/h3-4,7-8,11-13,17-18,21-23H,5-6,9-10H2,1-2H3,(H,24,25)/p-1/t12-,13+,17-,18-,21-/m1/s1 |
| InChIKey | AHNZPQNYGMNACV-PNNYZDKCSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icas#12(1−) (CHEBI:229462) has functional parent ascr#12(1−) (CHEBI:139621) |
| icas#12(1−) (CHEBI:229462) is a monocarboxylic acid anion (CHEBI:35757) |
| icas#12(1−) (CHEBI:229462) is conjugate base of icas#12 (CHEBI:79060) |
| Incoming Relation(s) |
| icas#12 (CHEBI:79060) is conjugate acid of icas#12(1−) (CHEBI:229462) |
| IUPAC Name |
|---|
| (5R)-5-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}hexanoate |
| Synonyms | Source |
|---|---|
| icas#12 anion | ChEBI |
| IC-asc-C6(1−) | ChEBI |
| IC-asc-C6 anion | ChEBI |