EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32NO7 |
| Net Charge | -1 |
| Average Mass | 446.520 |
| Monoisotopic Mass | 446.21843 |
| SMILES | C[C@H](CCCCCCC(=O)[O-])O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2cnc3ccccc23)C[C@H]1O |
| InChI | InChI=1S/C24H33NO7/c1-15(9-5-3-4-6-12-22(27)28)30-24-20(26)13-21(16(2)31-24)32-23(29)18-14-25-19-11-8-7-10-17(18)19/h7-8,10-11,14-16,20-21,24-26H,3-6,9,12-13H2,1-2H3,(H,27,28)/p-1/t15-,16+,20-,21-,24-/m1/s1 |
| InChIKey | VGNCAEIQHDZOLI-JTCUFRKPSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icas#10(1−) (CHEBI:140801) has functional parent ascr#10(1−) (CHEBI:139615) |
| icas#10(1−) (CHEBI:140801) is a monocarboxylic acid anion (CHEBI:35757) |
| icas#10(1−) (CHEBI:140801) is conjugate base of icas#10 (CHEBI:79029) |
| Incoming Relation(s) |
| icas#10 (CHEBI:79029) is conjugate acid of icas#10(1−) (CHEBI:140801) |
| IUPAC Name |
|---|
| (8R)-8-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}nonanoate |
| Synonyms | Source |
|---|---|
| icas#10 anion | ChEBI |
| IC-asc-C9(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| IC-asc-C9 | UniProt |
| Citations |
|---|