EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O2 |
| Net Charge | 0 |
| Average Mass | 400.647 |
| Monoisotopic Mass | 400.33413 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C27H44O2/c1-19-10-13-23(28)18-22(19)12-11-21-9-7-17-27(5)24(14-15-25(21)27)20(2)8-6-16-26(3,4)29/h11-12,20,23-25,28-29H,1,6-10,13-18H2,2-5H3/b21-11+,22-12-/t20-,23+,24-,25+,27-/m1/s1 |
| InChIKey | JWUBBDSIWDLEOM-DTOXIADCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Applications: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcidiol (CHEBI:17933) has role bone density conservation agent (CHEBI:50646) |
| calcidiol (CHEBI:17933) has role human metabolite (CHEBI:77746) |
| calcidiol (CHEBI:17933) has role metabolite (CHEBI:25212) |
| calcidiol (CHEBI:17933) has role mouse metabolite (CHEBI:75771) |
| calcidiol (CHEBI:17933) has role nutraceutical (CHEBI:50733) |
| calcidiol (CHEBI:17933) is a D3 vitamins (CHEBI:73558) |
| calcidiol (CHEBI:17933) is a diol (CHEBI:23824) |
| calcidiol (CHEBI:17933) is a hydroxycalciol (CHEBI:47042) |
| Incoming Relation(s) |
| calcidiol 25-O-(β-D-glucuronate) (CHEBI:139277) has functional parent calcidiol (CHEBI:17933) |
| calcidiol 25-O-(β-D-glucuronide) (CHEBI:139610) has functional parent calcidiol (CHEBI:17933) |
| calcidiol 3-O-(β-D-glucuronate) (CHEBI:139278) has functional parent calcidiol (CHEBI:17933) |
| calcidiol 3-O-(β-D-glucuronide) (CHEBI:139613) has functional parent calcidiol (CHEBI:17933) |
| IUPAC Name |
|---|
| (3S,5Z,7E)-9,10-secocholesta-5,7,10(19)-triene-3,25-diol |
| INNs | Source |
|---|---|
| calcifediolum | ChEBI |
| calcifédiol | ChEBI |
| calcifediol | ChEBI |
| calcifediol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Calcidiol | KEGG COMPOUND |
| 25-Hydroxyvitamin D3 | KEGG COMPOUND |
| Calcifediol | KEGG COMPOUND |
| Calcifediol anhydrous | KEGG COMPOUND |
| 25-hydroxycholecalciferol | JCBN |
| (5Z,7E)-(3S)-9,10-secocholesta-5,7,10(19)-triene-3,25-diol | JCBN |
| Brand Name | Source |
|---|---|
| Rayaldee | ChEBI |
| UniProt Name | Source |
|---|---|
| calcidiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01561 | KEGG COMPOUND |
| VDY | PDBeChem |
| LMST03020246 | LIPID MAPS |
| DB00146 | DrugBank |
| Calcifediol | Wikipedia |
| 464 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4270041 | Reaxys |
| CAS:19356-17-3 | KEGG COMPOUND |
| CAS:19356-17-3 | ChemIDplus |
| Citations |
|---|