EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17O3 |
| Net Charge | -1 |
| Average Mass | 209.265 |
| Monoisotopic Mass | 209.11832 |
| SMILES | CC/C=C\C[C@@H]1C(=O)CC[C@H]1CC(=O)[O-] |
| InChI | InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/p-1/b4-3-/t9-,10-/m0/s1 |
| InChIKey | ZNJFBWYDHIGLCU-CMIOBCHKSA-M |
| Roles Classification |
|---|
| Biological Role: | jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-jasmonic acid anion (CHEBI:138625) is a jasmonic acid anion (CHEBI:136184) |
| (+)-jasmonic acid anion (CHEBI:138625) is conjugate base of (+)-jasmonic acid (CHEBI:139300) |
| Incoming Relation(s) |
| (+)-jasmonic acid (CHEBI:139300) is conjugate acid of (+)-jasmonic acid anion (CHEBI:138625) |
| IUPAC Name |
|---|
| {(1S,2S)-3-oxo-2-[(2 Z)-pent-2-en-1-yl]cyclopentyl}acetate |
| Synonym | Source |
|---|---|
| (1S,2S)-jasmonic acid anion | ChEBI |
| UniProt Name | Source |
|---|---|
| (3S,7S)-jasmonate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 7251180 | PubChem Compound |
| Citations |
|---|