EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21NO2 |
| Net Charge | 0 |
| Average Mass | 235.327 |
| Monoisotopic Mass | 235.15723 |
| SMILES | COc1ccc(CN(C)CC2(C)COC2)cc1 |
| InChI | InChI=1S/C14H21NO2/c1-14(10-17-11-14)9-15(2)8-12-4-6-13(16-3)7-5-12/h4-7H,8-11H2,1-3H3 |
| InChIKey | PHGMVEPLTMCGOB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine (CHEBI:139160) is a aromatic ether (CHEBI:35618) |
| 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine (CHEBI:139160) is a oxetanes (CHEBI:38784) |
| 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine (CHEBI:139160) is a tertiary amino compound (CHEBI:50996) |
| 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine (CHEBI:139160) is conjugate base of 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine(1+) (CHEBI:139161) |
| Incoming Relation(s) |
| 2-{[(4-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol (CHEBI:139163) has functional parent 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine (CHEBI:139160) |
| 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine(1+) (CHEBI:139161) is conjugate acid of 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine (CHEBI:139160) |
| IUPAC Name |
|---|
| 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:31478921 | Reaxys |
| Citations |
|---|