EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22NO2 |
| Net Charge | +1 |
| Average Mass | 236.335 |
| Monoisotopic Mass | 236.16451 |
| SMILES | COc1ccc(C[NH+](C)CC2(C)COC2)cc1 |
| InChI | InChI=1S/C14H21NO2/c1-14(10-17-11-14)9-15(2)8-12-4-6-13(16-3)7-5-12/h4-7H,8-11H2,1-3H3/p+1 |
| InChIKey | PHGMVEPLTMCGOB-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine(1+) (CHEBI:139161) is a ammonium ion derivative (CHEBI:35274) |
| 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine(1+) (CHEBI:139161) is conjugate acid of 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine (CHEBI:139160) |
| Incoming Relation(s) |
| 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine (CHEBI:139160) is conjugate base of 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine(1+) (CHEBI:139161) |
| IUPAC Name |
|---|
| (4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanaminium |
| UniProt Name | Source |
|---|---|
| 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine | UniProt |
| Citations |
|---|