EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23NO3 |
| Net Charge | 0 |
| Average Mass | 253.342 |
| Monoisotopic Mass | 253.16779 |
| SMILES | COc1ccc(CN(C)CC(C)(CO)CO)cc1 |
| InChI | InChI=1S/C14H23NO3/c1-14(10-16,11-17)9-15(2)8-12-4-6-13(18-3)7-5-12/h4-7,16-17H,8-11H2,1-3H3 |
| InChIKey | LGEIPBYULZCRGR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[(4-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol (CHEBI:139163) has functional parent 1-(4-methoxyphenyl)-N-methyl-N-[(3-methyloxetan-3-yl)methyl]methanamine (CHEBI:139160) |
| 2-{[(4-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol (CHEBI:139163) is a aromatic ether (CHEBI:35618) |
| 2-{[(4-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol (CHEBI:139163) is a diol (CHEBI:23824) |
| 2-{[(4-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol (CHEBI:139163) is a tertiary amino compound (CHEBI:50996) |
| 2-{[(4-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol (CHEBI:139163) is conjugate base of 2-{[(4-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol(1+) (CHEBI:139164) |
| Incoming Relation(s) |
| 2-{[(4-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol(1+) (CHEBI:139164) is conjugate acid of 2-{[(4-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol (CHEBI:139163) |
| IUPAC Name |
|---|
| 2-{[(4-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol |
| Synonyms | Source |
|---|---|
| 2-({[(4-methoxyphenyl)methyl](methyl)amino}methyl)-2-methylpropane-1,3-diol | ChEBI |
| 2-{[(p-methoxybenzyl)(methyl)amino]methyl}-2-methylpropane-1,3-diol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:31478936 | Reaxys |
| Citations |
|---|