EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O4 |
| Net Charge | 0 |
| Average Mass | 476.742 |
| Monoisotopic Mass | 476.38656 |
| SMILES | [H][C@@]12CC=C3C(C)(C)[C@@H](O)CC[C@@]3([H])[C@]1(C)[C@H](O)C[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CC[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C30H52O4/c1-18(9-13-24(32)27(4,5)34)19-15-16-28(6)22-12-10-20-21(11-14-23(31)26(20,2)3)30(22,8)25(33)17-29(19,28)7/h10,18-19,21-25,31-34H,9,11-17H2,1-8H3/t18-,19-,21-,22+,23+,24-,25-,28+,29-,30+/m1/s1 |
| InChIKey | JLYBBRAAICDTIS-AYEHCKLZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mogrol (CHEBI:138974) has functional parent cucurbitadienol (CHEBI:62456) |
| mogrol (CHEBI:138974) has role antineoplastic agent (CHEBI:35610) |
| mogrol (CHEBI:138974) is a hydroxy seco-steroid (CHEBI:36853) |
| mogrol (CHEBI:138974) is a tetracyclic triterpenoid (CHEBI:26893) |
| Incoming Relation(s) |
| mogroside I-A1 (CHEBI:229951) has functional parent mogrol (CHEBI:138974) |
| mogroside IE (CHEBI:138975) has functional parent mogrol (CHEBI:138974) |
| mogroside IIA1 (CHEBI:232043) has functional parent mogrol (CHEBI:138974) |
| IUPAC Name |
|---|
| (1S,4R,9β,11α,24R)-9,10,14-trimethyl-4,9-cyclo-9,10-secocholest-5-ene-1,11,24,25-tetrol |
| Synonym | Source |
|---|---|
| (24R)-cucurbit-5-ene-3β,11α,24,25-tetraol | ChEBI |
| UniProt Name | Source |
|---|---|
| mogrol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20463 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9101900 | Reaxys |
| Citations |
|---|