EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H62O9 |
| Net Charge | 0 |
| Average Mass | 638.883 |
| Monoisotopic Mass | 638.43938 |
| SMILES | [H][C@@]12CC=C3C(C)(C)[C@@H](O)CC[C@@]3([H])[C@]1(C)[C@H](O)C[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CC[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(C)(C)O |
| InChI | InChI=1S/C36H62O9/c1-19(9-14-27(33(4,5)43)45-31-30(42)29(41)28(40)23(18-37)44-31)20-15-16-34(6)24-12-10-21-22(11-13-25(38)32(21,2)3)36(24,8)26(39)17-35(20,34)7/h10,19-20,22-31,37-43H,9,11-18H2,1-8H3/t19-,20-,22-,23-,24+,25+,26-,27-,28-,29+,30-,31+,34+,35-,36+/m1/s1 |
| InChIKey | UNCMRQFSKAVFQU-QZGPORMMSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mogroside I-A1 (CHEBI:229951) has functional parent mogrol (CHEBI:138974) |
| mogroside I-A1 (CHEBI:229951) has role plant metabolite (CHEBI:76924) |
| mogroside I-A1 (CHEBI:229951) is a mogroside (CHEBI:139477) |
| mogroside I-A1 (CHEBI:229951) is a monosaccharide derivative (CHEBI:63367) |
| mogroside I-A1 (CHEBI:229951) is a β-D-glucoside (CHEBI:22798) |
| Incoming Relation(s) |
| mogroside IIA (CHEBI:229960) has functional parent mogroside I-A1 (CHEBI:229951) |
| Synonyms | Source |
|---|---|
| M1-A1 | SUBMITTER |
| mogroside IA | SUBMITTER |
| UniProt Name | Source |
|---|---|
| mogroside I-A1 | UniProt |
| Citations |
|---|