EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H72O14 |
| Net Charge | 0 |
| Average Mass | 801.024 |
| Monoisotopic Mass | 800.49221 |
| SMILES | [H][C@@]12CC=C3C(C)(C)[C@@H](O)CC[C@@]3([H])[C@]1(C)[C@H](O)C[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CC[C@@H](O[C@@H]1O[C@H](CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O)C(C)(C)O |
| InChI | InChI=1S/C42H72O14/c1-20(21-15-16-40(6)26-12-10-22-23(11-13-27(44)38(22,2)3)42(26,8)28(45)17-41(21,40)7)9-14-29(39(4,5)52)56-37-35(51)33(49)31(47)25(55-37)19-53-36-34(50)32(48)30(46)24(18-43)54-36/h10,20-21,23-37,43-52H,9,11-19H2,1-8H3/t20-,21-,23-,24-,25-,26+,27+,28-,29-,30-,31-,32+,33+,34-,35-,36-,37+,40+,41-,42+/m1/s1 |
| InChIKey | NWPTUAQJIALPLJ-NCHDIWMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Momordica charantia (ncbitaxon:3673) | seed (BTO:0001226) | MetaboLights (MTBLS701) | |
| Siraitia grosvenorii (ncbitaxon:190515) | fruit (BTO:0000486) | PubMed (17477572) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mogroside IIA1 (CHEBI:232043) has functional parent mogrol (CHEBI:138974) |
| mogroside IIA1 (CHEBI:232043) has functional parent β-D-Glcp-(1→6)-β-D-Glcp (CHEBI:71422) |
| mogroside IIA1 (CHEBI:232043) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| mogroside IIA1 (CHEBI:232043) has role plant metabolite (CHEBI:76924) |
| mogroside IIA1 (CHEBI:232043) is a disaccharide derivative (CHEBI:63353) |
| mogroside IIA1 (CHEBI:232043) is a mogroside (CHEBI:139477) |
| mogroside IIA1 (CHEBI:232043) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (1S,4R,24R)-1,11α,25-trihydroxy-9α,10,14-trimethyl-8β-4,9-cyclo-9,10-secocholest-5-en-24-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| M2-A1 | SUBMITTER |
| mogroside II A1 | ChEBI |
| mogroside II-A1 | ChEBI |
| UniProt Name | Source |
|---|---|
| mogroside II-A1 | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:88901-44-4 | ChEBI |
| Citations |
|---|