EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N2O2 |
| Net Charge | +1 |
| Average Mass | 147.198 |
| Monoisotopic Mass | 147.11280 |
| SMILES | C[C@H]([NH3+])CC[C@@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H14N2O2/c1-4(7)2-3-5(8)6(9)10/h4-5H,2-3,7-8H2,1H3,(H,9,10)/p+1/t4-,5+/m0/s1 |
| InChIKey | CEVCRLBFUJAKOG-CRCLSJGQSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,5S)-2,5-diammoniohexanoate (CHEBI:137487) is a α-amino-acid cation (CHEBI:33719) |
| (2R,5S)-2,5-diammoniohexanoate (CHEBI:137487) is conjugate acid of (2R,5S)-2,5-diaminohexanoic acid (CHEBI:138193) |
| Incoming Relation(s) |
| (2R,5S)-2,5-diaminohexanoic acid (CHEBI:138193) is conjugate base of (2R,5S)-2,5-diammoniohexanoate (CHEBI:137487) |
| IUPAC Name |
|---|
| (2R,5S)-2,5-bis(azaniumyl)hexanoate |
| Synonym | Source |
|---|---|
| (2R,5S)-2,5-diaminohexanoic acid cation | ChEBI |
| UniProt Name | Source |
|---|---|
| (2R,5S)-2,5-diaminohexanoate | UniProt |
| Citations |
|---|