EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H21N3O4 |
| Net Charge | 0 |
| Average Mass | 439.471 |
| Monoisotopic Mass | 439.15321 |
| SMILES | O=C1OOC1(Cc1ccccc1)Nc1ncc(-c2ccc(O)cc2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C26H21N3O4/c30-21-13-11-20(12-14-21)23-17-27-24(22(28-23)15-18-7-3-1-4-8-18)29-26(25(31)32-33-26)16-19-9-5-2-6-10-19/h1-14,17,30H,15-16H2,(H,27,29) |
| InChIKey | SPOLSUBPKBTDTA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coelenterazine h dioxetanone (CHEBI:138063) has functional parent Renilla luciferin (CHEBI:16531) |
| coelenterazine h dioxetanone (CHEBI:138063) has role oxidized luciferins (CHEBI:25747) |
| coelenterazine h dioxetanone (CHEBI:138063) is a aromatic amine (CHEBI:33860) |
| coelenterazine h dioxetanone (CHEBI:138063) is a organic peroxide (CHEBI:25702) |
| coelenterazine h dioxetanone (CHEBI:138063) is a phenols (CHEBI:33853) |
| coelenterazine h dioxetanone (CHEBI:138063) is a pyrazines (CHEBI:38314) |
| coelenterazine h dioxetanone (CHEBI:138063) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 4-benzyl-4-{[3-benzyl-5-(4-hydroxyphenyl)pyrazin-2-yl]amino}-1,2-dioxetan-3-one |
| UniProt Name | Source |
|---|---|
| coelenterazine h dioxetanone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Coelenterazin-dioxetanone | MetaCyc |