EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H21N3O2 |
| Net Charge | 0 |
| Average Mass | 407.473 |
| Monoisotopic Mass | 407.16338 |
| SMILES | O=c1c(Cc2ccccc2)nc2c(Cc3ccccc3)nc(-c3ccc(O)cc3)cn1-2 |
| InChI | InChI=1S/C26H21N3O2/c30-21-13-11-20(12-14-21)24-17-29-25(22(27-24)15-18-7-3-1-4-8-18)28-23(26(29)31)16-19-9-5-2-6-10-19/h1-14,17,27,30H,15-16H2 |
| InChIKey | KAEGGIFPLJZUOZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. |
| Biological Role: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Renilla luciferin (CHEBI:16531) has parent hydride imidazo[1,2-a]pyrazine (CHEBI:37846) |
| Renilla luciferin (CHEBI:16531) has role luciferin (CHEBI:25078) |
| Renilla luciferin (CHEBI:16531) is a imidazopyrazine (CHEBI:37847) |
| Renilla luciferin (CHEBI:16531) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| Renilla luciferyl sulfate (CHEBI:17706) has functional parent Renilla luciferin (CHEBI:16531) |
| coelenterazine h dioxetanone (CHEBI:138063) has functional parent Renilla luciferin (CHEBI:16531) |
| oxidized Renilla luciferin (CHEBI:17959) has functional parent Renilla luciferin (CHEBI:16531) |
| IUPAC Name |
|---|
| 2,8-dibenzyl-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3(7H)-one |
| Synonyms | Source |
|---|---|
| 2-deoxycoelenterazine | MetaCyc |
| Renilla luciferin | KEGG COMPOUND |
| renillluciferin | ChEBI |
| UniProt Name | Source |
|---|---|
| coelenterazine h | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00982 | KEGG COMPOUND |
| RENILLA-LUCIFERIN | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Beilstein:768360 | Beilstein |
| CAS:50909-86-9 | ChemIDplus |
| Citations |
|---|