EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C5H8)n.C8H15NO2S |
| Net Charge | 0 |
| Average Mass | 257.399 |
| Monoisotopic Mass | 257.14495 |
| SMILES | CC(C)=CCC/C(C)=C/CSC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C13H23NO2S/c1-10(2)5-4-6-11(3)7-8-17-9-12(14)13(15)16/h5,7,12H,4,6,8-9,14H2,1-3H3,(H,15,16)/b11-7+/t12-/m0/s1 |
| InChIKey | OEMZZJFEMJBCHD-VNKGSWCUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-polyprenyl-L-cysteine zwitterion (CHEBI:137935) is a L-α-amino acid zwitterion (CHEBI:59869) |
| S-polyprenyl-L-cysteine zwitterion (CHEBI:137935) is tautomer of S-polyprenyl-L-cysteine (CHEBI:13796) |
| Incoming Relation(s) |
| S-[(2E,6E,10E)-geranylgeranyl]-L-cysteine zwitterion (CHEBI:189554) is a S-polyprenyl-L-cysteine zwitterion (CHEBI:137935) |
| S-[(2E,6E)-farnesyl]-L-cysteine zwitterion (CHEBI:62141) is a S-polyprenyl-L-cysteine zwitterion (CHEBI:137935) |
| S-prenyl-L-cysteine zwitterion (CHEBI:136985) is a S-polyprenyl-L-cysteine zwitterion (CHEBI:137935) |
| S-polyprenyl-L-cysteine (CHEBI:13796) is tautomer of S-polyprenyl-L-cysteine zwitterion (CHEBI:137935) |
| UniProt Name | Source |
|---|---|
| an S-prenyl-L-cysteine | UniProt |