EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31NO2S |
| Net Charge | 0 |
| Average Mass | 325.518 |
| Monoisotopic Mass | 325.20755 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C18H31NO2S/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-22-13-17(19)18(20)21/h7,9,11,17H,5-6,8,10,12-13,19H2,1-4H3,(H,20,21)/b15-9+,16-11+/t17-/m0/s1 |
| InChIKey | SYSLNQMKLROGCL-BCYUYYMPSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-[(2E,6E)-farnesyl]-L-cysteine zwitterion (CHEBI:62141) is a S-polyprenyl-L-cysteine zwitterion (CHEBI:137935) |
| S-[(2E,6E)-farnesyl]-L-cysteine zwitterion (CHEBI:62141) is a amino-acid zwitterion (CHEBI:35238) |
| S-[(2E,6E)-farnesyl]-L-cysteine zwitterion (CHEBI:62141) is tautomer of S-[(2E,6E)-farnesyl]-L-cysteine (CHEBI:62197) |
| Incoming Relation(s) |
| S-[(2E,6E)-farnesyl]-L-cysteinate residue (CHEBI:90510) is substituent group from S-[(2E,6E)-farnesyl]-L-cysteine zwitterion (CHEBI:62141) |
| S-[(2E,6E)-farnesyl]-L-cysteine (CHEBI:62197) is tautomer of S-[(2E,6E)-farnesyl]-L-cysteine zwitterion (CHEBI:62141) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-{[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]sulfanyl}propanoate |
| UniProt Name | Source |
|---|---|
| S-(2E,6E)-farnesyl-L-cysteine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12581 | MetaCyc |
| Citations |
|---|