EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO2S |
| Net Charge | 0 |
| Average Mass | 189.280 |
| Monoisotopic Mass | 189.08235 |
| SMILES | CC(C)=CCSC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C8H15NO2S/c1-6(2)3-4-12-5-7(9)8(10)11/h3,7H,4-5,9H2,1-2H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | ULHWZNASVJIOEM-ZETCQYMHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-prenyl-L-cysteine zwitterion (CHEBI:136985) is a S-polyprenyl-L-cysteine zwitterion (CHEBI:137935) |
| S-prenyl-L-cysteine zwitterion (CHEBI:136985) is a L-α-amino acid zwitterion (CHEBI:59869) |
| S-prenyl-L-cysteine zwitterion (CHEBI:136985) is tautomer of S-prenyl-L-cysteine (CHEBI:47914) |
| Incoming Relation(s) |
| S-prenyl-L-cysteine (CHEBI:47914) is tautomer of S-prenyl-L-cysteine zwitterion (CHEBI:136985) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-[(3-methylbut-2-en-1-yl)sulfanyl]propanoate |
| Synonym | Source |
|---|---|
| S-(3-methyl-2-butenyl)-L-cysteine zwitterion | SUBMITTER |
| UniProt Name | Source |
|---|---|
| S-prenyl-L-cysteine | UniProt |