EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10NO3 |
| Net Charge | -1 |
| Average Mass | 192.194 |
| Monoisotopic Mass | 192.06662 |
| SMILES | CC(=O)N[C@H](C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C10H11NO3/c1-7(12)11-9(10(13)14)8-5-3-2-4-6-8/h2-6,9H,1H3,(H,11,12)(H,13,14)/p-1/t9-/m0/s1 |
| InChIKey | VKDFZMMOLPIWQQ-VIFPVBQESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-α-phenylglycinate (CHEBI:136766) is a N-acetyl-L-α-amino acid anion (CHEBI:233443) |
| N-acetyl-L-α-phenylglycinate (CHEBI:136766) is a monocarboxylic acid anion (CHEBI:35757) |
| N-acetyl-L-α-phenylglycinate (CHEBI:136766) is conjugate base of N-acetyl-L-α-phenylglycine (CHEBI:137652) |
| Incoming Relation(s) |
| N-acetyl-L-α-phenylglycine (CHEBI:137652) is conjugate acid of N-acetyl-L-α-phenylglycinate (CHEBI:136766) |
| IUPAC Name |
|---|
| (2S)-acetamido(phenyl)acetate |
| Synonym | Source |
|---|---|
| N-acetyl-L-phenylglycinate | ChEBI |
| UniProt Name | Source |
|---|---|
| N-acetyl-L-α-phenylglycine | UniProt |