EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O5 |
| Net Charge | -2 |
| Average Mass | 210.185 |
| Monoisotopic Mass | 210.05392 |
| SMILES | CCC(=O)C1=C([O-])CC(C(=O)[O-])CC1=O |
| InChI | InChI=1S/C10H12O5/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13/h5,12H,2-4H2,1H3,(H,14,15)/p-2 |
| InChIKey | XLARNQQPQFWACL-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Roles: | gibberellin biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of gibberellins. plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prohexadione(2−) (CHEBI:137424) has role gibberellin biosynthesis inhibitor (CHEBI:73193) |
| prohexadione(2−) (CHEBI:137424) has role plant growth regulator (CHEBI:26155) |
| prohexadione(2−) (CHEBI:137424) is a organic anion (CHEBI:25696) |
| prohexadione(2−) (CHEBI:137424) is conjugate base of prohexadione (CHEBI:137380) |
| Incoming Relation(s) |
| prohexadione-calcium (CHEBI:137425) has part prohexadione(2−) (CHEBI:137424) |
| prohexadione (CHEBI:137380) is conjugate acid of prohexadione(2−) (CHEBI:137424) |
| IUPAC Name |
|---|
| 3-oxido-5-oxo-4-propionylcyclohex-3-ene-1-carboxylate |