EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O5 |
| Net Charge | 0 |
| Average Mass | 212.201 |
| Monoisotopic Mass | 212.06847 |
| SMILES | CCC(=O)C1C(=O)CC(C(=O)O)CC1=O |
| InChI | InChI=1S/C10H12O5/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13/h5,9H,2-4H2,1H3,(H,14,15) |
| InChIKey | BUCOQPHDYUOJSI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | gibberellin biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of gibberellins. plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. |
| Application: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prohexadione (CHEBI:137380) has role agrochemical (CHEBI:33286) |
| prohexadione (CHEBI:137380) has role gibberellin biosynthesis inhibitor (CHEBI:73193) |
| prohexadione (CHEBI:137380) has role plant growth regulator (CHEBI:26155) |
| prohexadione (CHEBI:137380) is a 4-oxo monocarboxylic acid (CHEBI:35950) |
| prohexadione (CHEBI:137380) is a β-triketone (CHEBI:140323) |
| prohexadione (CHEBI:137380) is conjugate acid of prohexadione(2−) (CHEBI:137424) |
| Incoming Relation(s) |
| prohexadione(2−) (CHEBI:137424) is conjugate base of prohexadione (CHEBI:137380) |
| IUPAC Name |
|---|
| 3,5-dioxo-4-propanoylcyclohexanecarboxylic acid |
| Synonyms | Source |
|---|---|
| 3,5-dioxo-4-(1-oxopropyl)cyclohexanecarboxylic acid | Alan Wood's Pesticides |
| 3,5-dioxo-4-propanoylcyclohexane-1-carboxylic acid | Alan Wood's Pesticides |
| 3,5-dioxo-4-propionylcyclohexanecarboxylic acid | IUPAC |
| DOCOC | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1719 | PPDB |
| EP123001 | Patent |
| prohexadione | Alan Wood's Pesticides |
| US4678496 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7763236 | Reaxys |
| CAS:88805-35-0 | Alan Wood's Pesticides |
| CAS:88805-35-0 | ChemIDplus |
| Citations |
|---|