EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O5.Ca |
| Net Charge | 0 |
| Average Mass | 250.263 |
| Monoisotopic Mass | 250.01541 |
| SMILES | CCC(=O)C1=C([O-])CC(C(=O)[O-])CC1=O.[Ca+2] |
| InChI | InChI=1S/C10H12O5.Ca/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13;/h5,12H,2-4H2,1H3,(H,14,15);/q;+2/p-2 |
| InChIKey | QKWLAUAUUGXSSE-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Roles: | gibberellin biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of gibberellins. plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. |
| Application: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prohexadione-calcium (CHEBI:137425) has part prohexadione(2−) (CHEBI:137424) |
| prohexadione-calcium (CHEBI:137425) has role agrochemical (CHEBI:33286) |
| prohexadione-calcium (CHEBI:137425) has role gibberellin biosynthesis inhibitor (CHEBI:73193) |
| prohexadione-calcium (CHEBI:137425) has role plant growth regulator (CHEBI:26155) |
| prohexadione-calcium (CHEBI:137425) is a calcium salt (CHEBI:35156) |
| IUPAC Name |
|---|
| calcium 3-oxido-5-oxo-4-propanoylcyclohex-3-ene-1-carboxylate |
| Synonyms | Source |
|---|---|
| BX-112 | ChEBI |
| calcium 3-oxido-5-oxo-4-propionylcyclohex-3-enecarboxylate | IUPAC |
| KIM-112 | ChEBI |
| KUH-833 | ChEBI |
| Pro-Ca | ChEBI |
| ProCa | ChEBI |
| Brand Names | Source |
|---|---|
| Medax Top | ChEBI |
| Regalis | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 539 | PPDB |
| CPD-15293 | MetaCyc |
| derivatives/prohexadione-calcium | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9738673 | Reaxys |
| CAS:127277-53-6 | Alan Wood's Pesticides |
| CAS:127277-53-6 | ChemIDplus |
| Citations |
|---|