EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N5O8PR |
| Net Charge | -1 |
| Average Mass (excl. R groups) | 373.216 |
| Monoisotopic Mass (excl. R groups) | 373.04235 |
| SMILES | *C(=O)OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| long-chain fatty acyl-AMP(1−) (CHEBI:136562) is a fatty acyl-AMP(1−) (CHEBI:83622) |
| long-chain fatty acyl-AMP(1−) (CHEBI:136562) is conjugate base of long-chain fatty acyl-AMP (CHEBI:137376) |
| Incoming Relation(s) |
| docosanoyl-AMP(1−) (CHEBI:142980) is a long-chain fatty acyl-AMP(1−) (CHEBI:136562) |
| hexadecanoyl-AMP(1−) (CHEBI:83627) is a long-chain fatty acyl-AMP(1−) (CHEBI:136562) |
| icosanoyl-AMP(1−) (CHEBI:142979) is a long-chain fatty acyl-AMP(1−) (CHEBI:136562) |
| octadecanoyl-AMP(1−) (CHEBI:142984) is a long-chain fatty acyl-AMP(1−) (CHEBI:136562) |
| tetradecanoyl-AMP(1−) (CHEBI:83626) is a long-chain fatty acyl-AMP(1−) (CHEBI:136562) |
| long-chain fatty acyl-AMP (CHEBI:137376) is conjugate acid of long-chain fatty acyl-AMP(1−) (CHEBI:136562) |
| UniProt Name | Source |
|---|---|
| a long-chain fatty acyl-AMP | UniProt |