EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (CH2)n.C5H11NO4S |
| Net Charge | 0 |
| Average Mass | 195.240 |
| Monoisotopic Mass | 195.05653 |
| SMILES | CSCCC[C@@H](C(=O)O)N(O)O |
| InChI | InChI=1S/C6H13NO4S/c1-12-4-2-3-5(6(8)9)7(10)11/h5,10-11H,2-4H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | CTFNBPCKMHCTPC-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dihydroxy-L-polyhomomethionine (CHEBI:137007) is a N,N-dihydroxy-α-amino acid (CHEBI:50766) |
| N,N-dihydroxy-L-polyhomomethionine (CHEBI:137007) is a methyl sulfide (CHEBI:86315) |
| N,N-dihydroxy-L-polyhomomethionine (CHEBI:137007) is conjugate acid of N,N-dihydroxy-L-polyhomomethioninate (CHEBI:134663) |
| Incoming Relation(s) |
| N,N-dihydroxy-L-dihomomethionine (CHEBI:137027) is a N,N-dihydroxy-L-polyhomomethionine (CHEBI:137007) |
| N,N-dihydroxy-L-hexahomomethionine (CHEBI:137033) is a N,N-dihydroxy-L-polyhomomethionine (CHEBI:137007) |
| N,N-dihydroxy-L-pentahomomethionine (CHEBI:137030) is a N,N-dihydroxy-L-polyhomomethionine (CHEBI:137007) |
| N,N-dihydroxy-L-tetrahomomethionine (CHEBI:137029) is a N,N-dihydroxy-L-polyhomomethionine (CHEBI:137007) |
| N,N-dihydroxy-L-trihomomethionine (CHEBI:137028) is a N,N-dihydroxy-L-polyhomomethionine (CHEBI:137007) |
| N,N-dihydroxy-L-polyhomomethioninate (CHEBI:134663) is conjugate base of N,N-dihydroxy-L-polyhomomethionine (CHEBI:137007) |
| Synonym | Source |
|---|---|
| N,N-dihydroxy-L-polyhomomethionines | ChEBI |