EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H23NO4S |
| Net Charge | 0 |
| Average Mass | 265.375 |
| Monoisotopic Mass | 265.13478 |
| SMILES | CSCCCCCCCC[C@@H](C(=O)O)N(O)O |
| InChI | InChI=1S/C11H23NO4S/c1-17-9-7-5-3-2-4-6-8-10(11(13)14)12(15)16/h10,15-16H,2-9H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | HNSLELPGRITQOV-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dihydroxy-L-hexahomomethionine (CHEBI:137033) is a N,N-dihydroxy-L-polyhomomethionine (CHEBI:137007) |
| N,N-dihydroxy-L-hexahomomethionine (CHEBI:137033) is a N,N-dihydroxyhexahomomethionine (CHEBI:50765) |
| N,N-dihydroxy-L-hexahomomethionine (CHEBI:137033) is conjugate acid of N,N-dihydroxy-L-hexahomomethioninate (CHEBI:134673) |
| Incoming Relation(s) |
| N,N-dihydroxy-L-hexahomomethioninate (CHEBI:134673) is conjugate base of N,N-dihydroxy-L-hexahomomethionine (CHEBI:137033) |
| IUPAC Name |
|---|
| (2S)-2-(dihydroxyamino)-10-(methylsulfanyl)decanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-14037 | MetaCyc |