EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19NO4S |
| Net Charge | 0 |
| Average Mass | 237.321 |
| Monoisotopic Mass | 237.10348 |
| SMILES | CSCCCCCC[C@@H](C(=O)O)N(O)O |
| InChI | InChI=1S/C9H19NO4S/c1-15-7-5-3-2-4-6-8(9(11)12)10(13)14/h8,13-14H,2-7H2,1H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | BMIHHOYYQXWVEG-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dihydroxy-L-tetrahomomethionine (CHEBI:137029) is a N,N-dihydroxy-L-polyhomomethionine (CHEBI:137007) |
| N,N-dihydroxy-L-tetrahomomethionine (CHEBI:137029) is a N,N-dihydroxytetrahomomethionine (CHEBI:50769) |
| N,N-dihydroxy-L-tetrahomomethionine (CHEBI:137029) is conjugate acid of N,N-dihydroxy-L-tetrahomomethioninate (CHEBI:134669) |
| Incoming Relation(s) |
| N,N-dihydroxy-L-tetrahomomethioninate (CHEBI:134669) is conjugate base of N,N-dihydroxy-L-tetrahomomethionine (CHEBI:137029) |
| IUPAC Name |
|---|
| (2S)-2-(dihydroxyamino)-8-(methylsulfanyl)octanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-14052 | MetaCyc |