EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO2S |
| Net Charge | 0 |
| Average Mass | 189.280 |
| Monoisotopic Mass | 189.08235 |
| SMILES | CC(C)=CCSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H15NO2S/c1-6(2)3-4-12-5-7(9)8(10)11/h3,7H,4-5,9H2,1-2H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | ULHWZNASVJIOEM-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-prenyl-L-cysteine (CHEBI:47914) is a S-hydrocarbyl-L-cysteine (CHEBI:47913) |
| S-prenyl-L-cysteine (CHEBI:47914) is a L-cysteine thioether (CHEBI:27532) |
| S-prenyl-L-cysteine (CHEBI:47914) is a prenylcysteine (CHEBI:60941) |
| S-prenyl-L-cysteine (CHEBI:47914) is tautomer of S-prenyl-L-cysteine zwitterion (CHEBI:136985) |
| Incoming Relation(s) |
| S-prenyl-L-cysteine zwitterion (CHEBI:136985) is tautomer of S-prenyl-L-cysteine (CHEBI:47914) |
| IUPAC Name |
|---|
| S-(3-methylbut-2-en-1-yl)-L-cysteine |
| INNs | Source |
|---|---|
| prenisteina | ChemIDplus |
| prenisteine | ChemIDplus |
| prenisteinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Amino-3-prenylmercaptopropionic acid | ChemIDplus |
| 2-Amino-3-prenylthiopropionic acid | ChemIDplus |
| 3-((3-Methyl-2-butenyl)thio)-L-alanine | ChemIDplus |
| S-dimethylallyl-L-cysteine | ChEBI |
| S-(3-Methyl-2-butenyl-L-cysteine) | ChemIDplus |
| S-Prenyl-L-cysteine | KEGG COMPOUND |