EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N2O5 |
| Net Charge | -2 |
| Average Mass | 302.286 |
| Monoisotopic Mass | 302.09137 |
| SMILES | O=C([O-])CCC(NC(=O)Cc1cnc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C15H16N2O5/c18-13(17-12(15(21)22)5-6-14(19)20)7-9-8-16-11-4-2-1-3-10(9)11/h1-4,8,12,16H,5-7H2,(H,17,18)(H,19,20)(H,21,22)/p-2 |
| InChIKey | YRKLGWOHYXIKSF-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(indole-3-acetyl)glutamate(2−) (CHEBI:133516) has role plant metabolite (CHEBI:76924) |
| N-(indole-3-acetyl)glutamate(2−) (CHEBI:133516) is a dicarboxylic acid dianion (CHEBI:28965) |
| N-(indole-3-acetyl)glutamate(2−) (CHEBI:133516) is conjugate base of N-(indole-3-acetyl)glutamic acid (CHEBI:136547) |
| Incoming Relation(s) |
| N-(indole-3-acetyl)glutamic acid (CHEBI:136547) is conjugate acid of N-(indole-3-acetyl)glutamate(2−) (CHEBI:133516) |
| IUPAC Name |
|---|
| 2-[2-(1H-indol-3-yl)acetamido]pentanedioate |
| Synonyms | Source |
|---|---|
| N-(indol-3-ylacetyl)glutamate(2−) | ChEBI |
| indole-3-acetyl-glutamate | ChEBI |
| indole-3-acetyl-glutamate(2−) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| INDOLE-3-ACETYL-GLU | MetaCyc |