EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:135223 - perfosfamide
| Formula | C7H15Cl2N2O4P |
| Net Charge | 0 |
| Average Mass | 293.087 |
| Monoisotopic Mass | 292.01465 |
| SMILES | O=[P@]1(N(CCCl)CCCl)N[C@H](OO)CCO1 |
| InChI | InChI=1S/C7H15Cl2N2O4P/c8-2-4-11(5-3-9)16(13)10-7(15-12)1-6-14-16/h7,12H,1-6H2,(H,10,13)/t7-,16-/m1/s1 |
| InChIKey | VPAWVRUHMJVRHU-VGDKGRGNSA-N |
| Roles Classification |
|---|
| Biological Role: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfosfamide (CHEBI:135223) has role antineoplastic agent (CHEBI:35610) |
| perfosfamide (CHEBI:135223) is a nitrogen mustard (CHEBI:37598) |
| INNs | Source |
|---|---|
| perfosfamida | WHO MedNet |
| perfosfamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-HC | ChEMBL |
| 4-hydroperoxycyclophosphamide | ChEMBL |
| hydroperoxycyclofosfamide | DrugCentral |
| NSC-181815 | ChEMBL |
| Brand Name | Source |
|---|---|
| Pergamid | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3430 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:62435-42-1 | DrugCentral |
| Citations |
|---|