EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O5 |
| Net Charge | 0 |
| Average Mass | 148.114 |
| Monoisotopic Mass | 148.03717 |
| SMILES | O=C1O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H8O5/c6-1-2-3(7)4(8)5(9)10-2/h2-4,6-8H,1H2/t2-,3+,4+/m1/s1 |
| InChIKey | CUOKHACJLGPRHD-UZBSEBFBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS355) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-lyxono-1,4-lactone (CHEBI:134539) has functional parent D-lyxonic acid (CHEBI:134538) |
| D-lyxono-1,4-lactone (CHEBI:134539) has role plant metabolite (CHEBI:76924) |
| D-lyxono-1,4-lactone (CHEBI:134539) is a aldonolactone (CHEBI:22302) |
| IUPAC Name |
|---|
| (3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one |
| Synonyms | Source |
|---|---|
| Lyxonic acid-1,4-lactone | ChEBI |
| (3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)dihydro-2(3H)-furanone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 10004245 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:82059 | Reaxys |
| Citations |
|---|