EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O4S |
| Net Charge | 0 |
| Average Mass | 204.247 |
| Monoisotopic Mass | 204.04563 |
| SMILES | CSCCC/C(=C/C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12O4S/c1-13-4-2-3-6(8(11)12)5-7(9)10/h5H,2-4H2,1H3,(H,9,10)(H,11,12)/b6-5- |
| InChIKey | RQAOZCCKOFEXBK-WAYWQWQTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-methylthiopropyl)maleic acid (CHEBI:134536) is a 2-(ω-methylthio)alkylmaleic acid (CHEBI:134534) |
| 2-(2-methylthiopropyl)maleic acid (CHEBI:134536) is conjugate acid of 2-(2-methylthio)propylmaleate(2−) (CHEBI:133500) |
| Incoming Relation(s) |
| 2-(2-methylthio)propylmaleate(2−) (CHEBI:133500) is conjugate base of 2-(2-methylthiopropyl)maleic acid (CHEBI:134536) |
| IUPAC Name |
|---|
| (2Z)-2-[3-(methylsulfanyl)propyl]but-2-enedioic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-19477 | MetaCyc |