EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O4S |
| Net Charge | -2 |
| Average Mass | 202.231 |
| Monoisotopic Mass | 202.03108 |
| SMILES | CSCCC/C(=C/C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H12O4S/c1-13-4-2-3-6(8(11)12)5-7(9)10/h5H,2-4H2,1H3,(H,9,10)(H,11,12)/p-2/b6-5- |
| InChIKey | RQAOZCCKOFEXBK-WAYWQWQTSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-methylthio)propylmaleate(2−) (CHEBI:133500) is a 2-(ω-methylthio)alkylmaleate(2−) (CHEBI:133498) |
| 2-(2-methylthio)propylmaleate(2−) (CHEBI:133500) is conjugate base of 2-(2-methylthiopropyl)maleic acid (CHEBI:134536) |
| Incoming Relation(s) |
| 2-(2-methylthiopropyl)maleic acid (CHEBI:134536) is conjugate acid of 2-(2-methylthio)propylmaleate(2−) (CHEBI:133500) |
| IUPAC Name |
|---|
| (2Z)-2-[3-(methylsulfanyl)propyl]but-2-enedioate |
| UniProt Name | Source |
|---|---|
| 2-(2-methylsulfanyl)propylmaleate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19477 | MetaCyc |