EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:134407 - prostaglandin H3
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | CC/C=C\C[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H]2C[C@H]1OO2 |
| InChI | InChI=1S/C20H30O5/c1-2-3-6-9-15(21)12-13-17-16(18-14-19(17)25-24-18)10-7-4-5-8-11-20(22)23/h3-4,6-7,12-13,15-19,21H,2,5,8-11,14H2,1H3,(H,22,23)/b6-3-,7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | PVTQTOGPOPGQGE-SAMSIYEGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (2491846) |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin H3 (CHEBI:134407) has role human metabolite (CHEBI:77746) |
| prostaglandin H3 (CHEBI:134407) is a olefinic compound (CHEBI:78840) |
| prostaglandin H3 (CHEBI:134407) is a prostaglandins H (CHEBI:26344) |
| prostaglandin H3 (CHEBI:134407) is a secondary alcohol (CHEBI:35681) |
| prostaglandin H3 (CHEBI:134407) is conjugate acid of prostaglandin H3(1−) (CHEBI:133134) |
| Incoming Relation(s) |
| prostaglandin H3(1−) (CHEBI:133134) is conjugate base of prostaglandin H3 (CHEBI:134407) |
| IUPAC Name |
|---|
| (5Z)-7-{(1R,4S,5R,6R)-6-[(1E,3S,,5Z)-3-hydroxyocta-1,5-dien-1-yl]-2,3-dioxabicyclo[2.2.1]heptan-5-yl}hept-5-enoic acid |
| Synonyms | Source |
|---|---|
| PGH3 | ChemIDplus |
| (5Z,9S,11R,13E,15S,17Z)-15-hydroxy-9,11-epidioxyprosta-5,13,17-trienoic acid | ChEBI |
| (5Z,9alpha,11alpha,13E,15S,17Z)-9,11-Epidioxy-15-hydroxyprosta-5,13,17-trien-1-oic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:30529584 | Reaxys |
| CAS:60114-66-1 | ChemIDplus |
| Citations |
|---|