EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O5 |
| Net Charge | -1 |
| Average Mass | 349.447 |
| Monoisotopic Mass | 349.20205 |
| SMILES | CC/C=C\C[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)[O-])[C@@H]2C[C@H]1OO2 |
| InChI | InChI=1S/C20H30O5/c1-2-3-6-9-15(21)12-13-17-16(18-14-19(17)25-24-18)10-7-4-5-8-11-20(22)23/h3-4,6-7,12-13,15-19,21H,2,5,8-11,14H2,1H3,(H,22,23)/p-1/b6-3-,7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | PVTQTOGPOPGQGE-SAMSIYEGSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin H3(1−) (CHEBI:133134) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| prostaglandin H3(1−) (CHEBI:133134) is conjugate base of prostaglandin H3 (CHEBI:134407) |
| Incoming Relation(s) |
| prostaglandin H3 (CHEBI:134407) is conjugate acid of prostaglandin H3(1−) (CHEBI:133134) |
| IUPAC Name |
|---|
| (5Z)-7-{(1R,4S,5R,6R)-6-[(1E,3S,,5Z)-3-hydroxyocta-1,5-dien-1-yl]-2,3-dioxabicyclo[2.2.1]heptan-5-yl}hept-5-enoate |
| Synonym | Source |
|---|---|
| (5Z,9S,11R,13E,15S,17Z)-15-hydroxy-9,11-epidioxyprosta-5,13,17-trienoate | ChEBI |
| UniProt Name | Source |
|---|---|
| prostaglandin H3 | UniProt |