EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O5 |
| Net Charge | 0 |
| Average Mass | 298.379 |
| Monoisotopic Mass | 298.17802 |
| SMILES | [H][C@@]1([C@H](O)/C=C/C(=O)O)C[C@@H](O)C[C@H]1/C=C/CCC[C@H](C)O |
| InChI | InChI=1S/C16H26O5/c1-11(17)5-3-2-4-6-12-9-13(18)10-14(12)15(19)7-8-16(20)21/h4,6-8,11-15,17-19H,2-3,5,9-10H2,1H3,(H,20,21)/b6-4+,8-7+/t11-,12+,13-,14+,15+/m0/s1 |
| InChIKey | JFMRAARESGPLQF-KQPMLPITSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TX-1875 (CHEBI:134260) has functional parent brefeldin A (CHEBI:48080) |
| TX-1875 (CHEBI:134260) is a 4-hydroxy monocarboxylic acid (CHEBI:35970) |
| TX-1875 (CHEBI:134260) is a alicyclic compound (CHEBI:33654) |
| TX-1875 (CHEBI:134260) is a secondary allylic alcohol (CHEBI:134396) |
| TX-1875 (CHEBI:134260) is a semisynthetic derivative (CHEBI:72588) |
| TX-1875 (CHEBI:134260) is a triol (CHEBI:27136) |
| TX-1875 (CHEBI:134260) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E,4R)-4-hydroxy-4-{(1R,2S,4S)-4-hydroxy-2-[(1E,6S)-6-hydroxyhept-1-en-1-yl]cyclopentyl}but-2-enoic acid |
| Synonyms | Source |
|---|---|
| BFA seco-acid | ChEBI |
| brefeldin A seco-acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7646570 | Reaxys |
| Citations |
|---|