EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O4 |
| Net Charge | 0 |
| Average Mass | 280.364 |
| Monoisotopic Mass | 280.16746 |
| SMILES | [H][C@@]12C[C@@H](O)C[C@@]1([H])/C=C/CCC[C@H](C)OC(=O)/C=C/[C@H]2O |
| InChI | InChI=1S/C16H24O4/c1-11-5-3-2-4-6-12-9-13(17)10-14(12)15(18)7-8-16(19)20-11/h4,6-8,11-15,17-18H,2-3,5,9-10H2,1H3/b6-4+,8-7+/t11-,12+,13-,14+,15+/m0/s1 |
| InChIKey | KQNZDYYTLMIZCT-KQPMLPITSA-N |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brefeldin A (CHEBI:48080) has role Penicillium metabolite (CHEBI:76964) |
| brefeldin A (CHEBI:48080) is a macrolide antibiotic (CHEBI:25105) |
| Incoming Relation(s) |
| TX-1875 (CHEBI:134260) has functional parent brefeldin A (CHEBI:48080) |
| IUPAC Name |
|---|
| (1R,2E,6S,10E,11aS,13S,14aR)-1,13-dihydroxy-6-methyl-1,6,7,8,9,11a,12,13,14,14a-decahydro-4H-cyclopenta[f]oxacyclotridecin-4-one |
| Synonyms | Source |
|---|---|
| ascotoxin | ChemIDplus |
| Brefeldin A | ChemIDplus |
| cyanein | ChemIDplus |
| decumbin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:25191 | Beilstein |
| Beilstein:5282047 | Beilstein |
| CAS:20350-15-6 | ChemIDplus |