EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N2O6 |
| Net Charge | -1 |
| Average Mass | 247.227 |
| Monoisotopic Mass | 247.09356 |
| SMILES | C[C@@H](O)[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H16N2O6/c1-4(12)7(9(16)17)11-6(13)3-2-5(10)8(14)15/h4-5,7,12H,2-3,10H2,1H3,(H,11,13)(H,14,15)(H,16,17)/p-1/t4-,5+,7+/m1/s1 |
| InChIKey | GWNXFCYUJXASDX-ZDLURKLDSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-γ-Glu-L-Thr(1−) (CHEBI:133717) has role human metabolite (CHEBI:77746) |
| L-γ-Glu-L-Thr(1−) (CHEBI:133717) is a peptide anion (CHEBI:60334) |
| L-γ-Glu-L-Thr(1−) (CHEBI:133717) is conjugate base of L-γ-Glu-L-Thr (CHEBI:133747) |
| Incoming Relation(s) |
| L-γ-Glu-L-Thr (CHEBI:133747) is conjugate acid of L-γ-Glu-L-Thr(1−) (CHEBI:133717) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-{[(1S,2R)-1-carboxylato-2-hydroxypropyl]amino}-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| L-γ-Glu-L-Thr(1−) | ChEBI |
| L-γ-glutamyl-L-threoninate | ChEBI |