EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O3 |
| Net Charge | -1 |
| Average Mass | 131.151 |
| Monoisotopic Mass | 131.07137 |
| SMILES | CCCCC(O)C(=O)[O-] |
| InChI | InChI=1S/C6H12O3/c1-2-3-4-5(7)6(8)9/h5,7H,2-4H2,1H3,(H,8,9)/p-1 |
| InChIKey | NYHNVHGFPZAZGA-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyhexanoate (CHEBI:133738) has role animal metabolite (CHEBI:75767) |
| 2-hydroxyhexanoate (CHEBI:133738) is a 2-hydroxy fatty acid anion (CHEBI:76176) |
| 2-hydroxyhexanoate (CHEBI:133738) is a medium-chain fatty acid anion (CHEBI:59558) |
| 2-hydroxyhexanoate (CHEBI:133738) is conjugate base of 2-hydroxyhexanoic acid (CHEBI:86542) |
| Incoming Relation(s) |
| (2R)-hydroxyhexanoate (CHEBI:232386) is a 2-hydroxyhexanoate (CHEBI:133738) |
| 2-hydroxyhexanoic acid (CHEBI:86542) is conjugate acid of 2-hydroxyhexanoate (CHEBI:133738) |
| IUPAC Name |
|---|
| 2-hydroxyhexanoate |
| Synonyms | Source |
|---|---|
| 2-hydroxycaproate | ChEBI |
| 2-hydroxyhexanoic acid | ChEBI |
| α-hydroxycaproate | ChEBI |
| α-hydroxyhexanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-hydroxyhexanoate | UniProt |