EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O3 |
| Net Charge | -1 |
| Average Mass | 131.151 |
| Monoisotopic Mass | 131.07137 |
| SMILES | CCCC[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C6H12O3/c1-2-3-4-5(7)6(8)9/h5,7H,2-4H2,1H3,(H,8,9)/p-1/t5-/m1/s1 |
| InChIKey | NYHNVHGFPZAZGA-RXMQYKEDSA-M |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-hydroxyhexanoate (CHEBI:232386) is a 2-hydroxyhexanoate (CHEBI:133738) |
| Synonym | Source |
|---|---|
| (2R)-hydroxycaproate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (2R)-hydroxyhexanoate | UniProt |