EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O3 |
| Net Charge | 0 |
| Average Mass | 132.159 |
| Monoisotopic Mass | 132.07864 |
| SMILES | CCCCC(O)C(=O)O |
| InChI | InChI=1S/C6H12O3/c1-2-3-4-5(7)6(8)9/h5,7H,2-4H2,1H3,(H,8,9) |
| InChIKey | NYHNVHGFPZAZGA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhincodon typus (ncbitaxon:259920) | sap (NCIT:C79665) | PubMed (23166652) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyhexanoic acid (CHEBI:86542) has functional parent hexanoic acid (CHEBI:30776) |
| 2-hydroxyhexanoic acid (CHEBI:86542) has role animal metabolite (CHEBI:75767) |
| 2-hydroxyhexanoic acid (CHEBI:86542) is a hydroxy fatty acid (CHEBI:24654) |
| 2-hydroxyhexanoic acid (CHEBI:86542) is conjugate acid of 2-hydroxyhexanoate (CHEBI:133738) |
| Incoming Relation(s) |
| 2-hydroxyhexanoyl-CoA (CHEBI:139304) has functional parent 2-hydroxyhexanoic acid (CHEBI:86542) |
| 2-hydroxyhexanoate (CHEBI:133738) is conjugate base of 2-hydroxyhexanoic acid (CHEBI:86542) |
| IUPAC Name |
|---|
| 2-hydroxyhexanoic acid |
| Synonym | Source |
|---|---|
| 2-hydroxycaproic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001624 | HMDB |
| LMFA01050011 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721752 | Reaxys |
| CAS:6064-63-7 | ChemIDplus |
| Citations |
|---|