EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O8 |
| Net Charge | 0 |
| Average Mass | 300.263 |
| Monoisotopic Mass | 300.08452 |
| SMILES | O=C(OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccccc1O |
| InChI | InChI=1S/C13H16O8/c14-5-8-9(16)10(17)11(18)13(20-8)21-12(19)6-3-1-2-4-7(6)15/h1-4,8-11,13-18H,5H2/t8-,9-,10+,11-,13?/m1/s1 |
| InChIKey | XNHKMZHWRNMFCU-TWEVDUBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucosyl salicylate (CHEBI:133564) has functional parent salicylic acid (CHEBI:16914) |
| D-glucosyl salicylate (CHEBI:133564) has role plant metabolite (CHEBI:76924) |
| D-glucosyl salicylate (CHEBI:133564) is a O-acyl carbohydrate (CHEBI:52782) |
| D-glucosyl salicylate (CHEBI:133564) is a D-glucoside (CHEBI:35436) |
| D-glucosyl salicylate (CHEBI:133564) is a benzoate ester (CHEBI:36054) |
| D-glucosyl salicylate (CHEBI:133564) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| β-D-glucosyl salicylate (CHEBI:145681) is a D-glucosyl salicylate (CHEBI:133564) |
| IUPAC Name |
|---|
| 1-O-(2-hydroxybenzoyl)-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 1-O-(2-hydroxybenzoyl)-D-glucose | ChEBI |
| 1-O-salicyl-D-glucose | ChEBI |
| salicylate-D-glucose ester | ChEBI |