EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:145681 |
| ChEBI Name | β-D-glucosyl salicylate |
| Stars | |
| ASCII Name | beta-D-glucosyl salicylate |
| Definition | A D-glucosyl salicylate in which the glucosyl moiety has β-configuration at the anomeric centre. A transferrin binding compound used in research for cancer therapy. |
| Last Modified | 6 January 2020 |
| Submitter | Kristian Axelsen |
| Downloads |
| Formula | C13H16O8 |
| Net Charge | 0 |
| Average Mass | 300.263 |
| Monoisotopic Mass | 300.08452 |
| SMILES | O=C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccccc1O |
| InChI | InChI=1S/C13H16O8/c14-5-8-9(16)10(17)11(18)13(20-8)21-12(19)6-3-1-2-4-7(6)15/h1-4,8-11,13-18H,5H2/t8-,9-,10+,11-,13+/m1/s1 |
| InChIKey | XNHKMZHWRNMFCU-HMUNZLOLSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-glucosyl salicylate (CHEBI:145681) is a D-glucosyl salicylate (CHEBI:133564) |
| β-D-glucosyl salicylate (CHEBI:145681) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 1-O-(2-hydroxybenzoyl)-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 1-O-(o-hydroxybenzoyl)-β-D-glucopyranose | ChEBI |
| salicylate-β-D-glucose ester | SUBMITTER |
| 1-O-salicyl-β-D-glucose | ChEBI |
| salicylic acid β-D-glucose ester | MetaCyc |
| β-D-glucopyranosyl salicylate | ChEBI |
| salicylic acid β-D-glucopyranosyl ester | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-O-salicyl-β-D-glucose | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12629 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:60517-74-0 | PubChem Compound |