EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O3 |
| Net Charge | 0 |
| Average Mass | 288.347 |
| Monoisotopic Mass | 288.14739 |
| SMILES | CC(C)C[C@H](NC(=O)Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-10(2)7-14(16(20)21)18-15(19)8-11-9-17-13-6-4-3-5-12(11)13/h3-6,9-10,14,17H,7-8H2,1-2H3,(H,18,19)(H,20,21)/t14-/m0/s1 |
| InChIKey | HCZNPUHZYPPINM-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(indole-3-acetyl)-L-leucine (CHEBI:71675) is a N-(indole-3-acetyl)leucine (CHEBI:133521) |
| N-(indole-3-acetyl)-L-leucine (CHEBI:71675) is a N-acyl-L-amino acid (CHEBI:21644) |
| N-(indole-3-acetyl)-L-leucine (CHEBI:71675) is a L-leucine derivative (CHEBI:25018) |
| IUPAC Name |
|---|
| N-(1H-indol-3-ylacetyl)-L-leucine |
| Synonyms | Source |
|---|---|
| N-(indole-3-acetyl)leucine | ChEBI |
| IAA-Leu | ChEBI |
| IAA-L-Leu | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6933304 | Reaxys |