EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O16 |
| Net Charge | 0 |
| Average Mass | 610.521 |
| Monoisotopic Mass | 610.15338 |
| SMILES | O=c1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(-c2ccc(O)cc2)oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c12 |
| InChI | InChI=1S/C27H30O16/c28-7-14-17(32)20(35)22(37)26(41-14)39-11-5-12(31)16-13(6-11)40-24(9-1-3-10(30)4-2-9)25(19(16)34)43-27-23(38)21(36)18(33)15(8-29)42-27/h1-6,14-15,17-18,20-23,26-33,35-38H,7-8H2/t14-,15-,17-,18-,20+,21+,22-,23-,26-,27+/m1/s1 |
| InChIKey | XFFQVRFGLSBFON-DEFKTLOSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allium macrostemon (ncbitaxon:91198) | leaf (BTO:0000713) | PubMed (26434122) | |
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | MetaboLights (MTBLS129) | From MetaboLights | |
| - | MetaboLights (MTBLS129) | ||
| - | PubMed (27432888) | ||
| Delphinium staphisagria (ncbitaxon:104301) | aerial part (BTO:0001658) | PubMed (21466157) | 80% ethanolic extract of chopped fresh plant |
| Equisetum debile (ncbitaxon:232203) | aerial part (BTO:0001658) | PubMed (17666861) | |
| Paeonia suffruticosa (ncbitaxon:45171) | flower (BTO:0000469) | PubMed (24504864) | |
| Pelargonium graveolens (ncbitaxon:73200) | - | PubMed (23027699) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol 3,7-di-O-β-D-glucoside (CHEBI:133224) has role plant metabolite (CHEBI:76924) |
| kaempferol 3,7-di-O-β-D-glucoside (CHEBI:133224) has role trypanocidal drug (CHEBI:36335) |
| kaempferol 3,7-di-O-β-D-glucoside (CHEBI:133224) is a dihydroxyflavone (CHEBI:38686) |
| kaempferol 3,7-di-O-β-D-glucoside (CHEBI:133224) is a kaempferol O-glucoside (CHEBI:64634) |
| kaempferol 3,7-di-O-β-D-glucoside (CHEBI:133224) is a β-D-glucoside (CHEBI:22798) |
| Incoming Relation(s) |
| 2''-acetylpaeonoside (CHEBI:67929) has functional parent kaempferol 3,7-di-O-β-D-glucoside (CHEBI:133224) |
| paeonoside decaacetate (CHEBI:67930) has functional parent kaempferol 3,7-di-O-β-D-glucoside (CHEBI:133224) |
| IUPAC Names |
|---|
| 3-(β-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-7-yl β-D-glucopyranoside |
| 3-(β-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 3,7-bis(β-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| Kaempferol 3,7-diglucoside | LIPID MAPS |
| Kaempferol 3,7-di-O-glucoside | ChemIDplus |
| kaempferol-3,7- di-β-D-glucopyranoside | ChEBI |
| Kaempferol 3,7-O-β-D-diglucopyranoside | KNApSAcK |
| Kaempferol-3-O-β-D-glucosyl-7-O-β-D-glucoside | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 24784758 | ChemSpider |
| C00005182 | KNApSAcK |
| CPD-8034 | MetaCyc |
| FDB016484 | FooDB |
| HMDB0037433 | HMDB |
| LMPK12111738 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1339818 | Reaxys |
| CAS:25615-14-9 | ChemIDplus |
| Citations |
|---|