EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32O17 |
| Net Charge | 0 |
| Average Mass | 652.558 |
| Monoisotopic Mass | 652.16395 |
| SMILES | CC(=O)O[C@H]1[C@H](Oc2c(-c3ccc(O)cc3)oc3cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)c3c2=O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H32O17/c1-10(32)41-27-23(39)20(36)17(9-31)45-29(27)46-26-21(37)18-14(34)6-13(42-28-24(40)22(38)19(35)16(8-30)44-28)7-15(18)43-25(26)11-2-4-12(33)5-3-11/h2-7,16-17,19-20,22-24,27-31,33-36,38-40H,8-9H2,1H3/t16-,17-,19-,20-,22+,23+,24-,27-,28-,29+/m1/s1 |
| InChIKey | UNCGSIXTLZAFKK-RXRZWAIISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Delphinium staphisagria (ncbitaxon:104301) | aerial part (BTO:0001658) | PubMed (21466157) | 80% ethanolic extract of chopped fresh plant |
| Roles Classification |
|---|
| Biological Roles: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2''-acetylpaeonoside (CHEBI:67929) has functional parent kaempferol 3,7-di-O-β-D-glucoside (CHEBI:133224) |
| 2''-acetylpaeonoside (CHEBI:67929) has role metabolite (CHEBI:25212) |
| 2''-acetylpaeonoside (CHEBI:67929) has role plant metabolite (CHEBI:76924) |
| 2''-acetylpaeonoside (CHEBI:67929) has role trypanocidal drug (CHEBI:36335) |
| 2''-acetylpaeonoside (CHEBI:67929) is a acetate ester (CHEBI:47622) |
| 2''-acetylpaeonoside (CHEBI:67929) is a dihydroxyflavone (CHEBI:38686) |
| 2''-acetylpaeonoside (CHEBI:67929) is a kaempferol O-glucoside (CHEBI:64634) |
| 2''-acetylpaeonoside (CHEBI:67929) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 7-(β-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-acetyl-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1338924 | Reaxys |
| Citations |
|---|