EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32O17 |
| Net Charge | 0 |
| Average Mass | 652.558 |
| Monoisotopic Mass | 652.16395 |
| SMILES | CC(=O)O[C@H]1[C@H](Oc2c(-c3ccc(O)cc3)oc3cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)c3c2=O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H32O17/c1-10(32)41-27-23(39)20(36)17(9-31)45-29(27)46-26-21(37)18-14(34)6-13(42-28-24(40)22(38)19(35)16(8-30)44-28)7-15(18)43-25(26)11-2-4-12(33)5-3-11/h2-7,16-17,19-20,22-24,27-31,33-36,38-40H,8-9H2,1H3/t16-,17-,19-,20-,22+,23+,24-,27-,28-,29+/m1/s1 |
| InChIKey | UNCGSIXTLZAFKK-RXRZWAIISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Delphinium staphisagria (ncbitaxon:104301) | aerial part (BTO:0001658) | PubMed (21466157) | 80% ethanolic extract of chopped fresh plant |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2''-acetylpaeonoside (CHEBI:67929) has functional parent kaempferol 3,7-di-O-β-D-glucoside (CHEBI:133224) |
| 2''-acetylpaeonoside (CHEBI:67929) has role metabolite (CHEBI:25212) |
| 2''-acetylpaeonoside (CHEBI:67929) has role plant metabolite (CHEBI:76924) |
| 2''-acetylpaeonoside (CHEBI:67929) has role trypanocidal drug (CHEBI:36335) |
| 2''-acetylpaeonoside (CHEBI:67929) is a acetate ester (CHEBI:47622) |
| 2''-acetylpaeonoside (CHEBI:67929) is a dihydroxyflavone (CHEBI:38686) |
| 2''-acetylpaeonoside (CHEBI:67929) is a kaempferol O-glucoside (CHEBI:64634) |
| 2''-acetylpaeonoside (CHEBI:67929) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 7-(β-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-acetyl-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1338924 | Reaxys |
| Citations |
|---|